C12H18BrNO4S — CID 143839197
tert-butyl N-[1-(5-bromofuran-2-yl)-2-methylsulfinylethyl]carbamate (PubChem CID 143839197) has the molecular formula C12H18BrNO4S and a molecular weight of 352.25 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromofuran-2-yl)-2-methylsulfinylethyl]carbamate.
| Compound Name | tert-butyl N-[1-(5-bromofuran-2-yl)-2-methylsulfinylethyl]carbamate |
|---|---|
| PubChem CID | 143839197 |
| Molecular Formula | C12H18BrNO4S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | tert-butyl N-[1-(5-bromofuran-2-yl)-2-methylsulfinylethyl]carbamate |
| SMILES | CS(=O)CC(NC(=O)OC(C)(C)C)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H18BrNO4S/c1-12(2,3)18-11(15)14-8(7-19(4)16)9-5-6-10(13)17-9/h5-6,8H,7H2,1-4H3,(H,14,15) |
| InChIKey | BHMJBRQCBKKGDB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |