C16H27NO3 — CID 11492885
tert-butyl N-[1-(5-propan-2-ylfuran-2-yl)butyl]carbamate (PubChem CID 11492885) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl N-[1-(5-propan-2-ylfuran-2-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[1-(5-propan-2-ylfuran-2-yl)butyl]carbamate |
|---|---|
| PubChem CID | 11492885 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tert-butyl N-[1-(5-propan-2-ylfuran-2-yl)butyl]carbamate |
| SMILES | CCCC(NC(=O)OC(C)(C)C)c1ccc(C(C)C)o1 |
| InChI | InChI=1S/C16H27NO3/c1-7-8-12(17-15(18)20-16(4,5)6)14-10-9-13(19-14)11(2)3/h9-12H,7-8H2,1-6H3,(H,17,18) |
| InChIKey | FANQNAZIRZCCQL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |