C15H27N3O3S — CID 104943718
tert-butyl N-[(1R)-1-[3-(1-methylsulfinylpropan-2-yl)imidazol-4-yl]propyl]carbamate (PubChem CID 104943718) has the molecular formula C15H27N3O3S and a molecular weight of 329.47 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[3-(1-methylsulfinylpropan-2-yl)imidazol-4-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[3-(1-methylsulfinylpropan-2-yl)imidazol-4-yl]propyl]carbamate |
|---|---|
| PubChem CID | 104943718 |
| Molecular Formula | C15H27N3O3S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl N-[(1R)-1-[3-(1-methylsulfinylpropan-2-yl)imidazol-4-yl]propyl]carbamate |
| SMILES | CC[C@@H](NC(=O)OC(C)(C)C)c1cncn1C(C)CS(C)=O |
| InChI | InChI=1S/C15H27N3O3S/c1-7-12(17-14(19)21-15(3,4)5)13-8-16-10-18(13)11(2)9-22(6)20/h8,10-12H,7,9H2,1-6H3,(H,17,19)/t11?,12-,22?/m1/s1 |
| InChIKey | JGYYAGKXXHZCEK-SHYLRTJGSA-N |
| XLogP | 2.80 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |