C17H29N3O3 — CID 104944062
tert-butyl N-[(1R)-1-[3-[1-(oxolan-3-yl)ethyl]imidazol-4-yl]propyl]carbamate (PubChem CID 104944062) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[3-[1-(oxolan-3-yl)ethyl]imidazol-4-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[3-[1-(oxolan-3-yl)ethyl]imidazol-4-yl]propyl]carbamate |
|---|---|
| PubChem CID | 104944062 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl N-[(1R)-1-[3-[1-(oxolan-3-yl)ethyl]imidazol-4-yl]propyl]carbamate |
| SMILES | CC[C@@H](NC(=O)OC(C)(C)C)c1cncn1C(C)C1CCOC1 |
| InChI | InChI=1S/C17H29N3O3/c1-6-14(19-16(21)23-17(3,4)5)15-9-18-11-20(15)12(2)13-7-8-22-10-13/h9,11-14H,6-8,10H2,1-5H3,(H,19,21)/t12?,13?,14-/m1/s1 |
| InChIKey | URHYBPSREWLUAX-JXQTWKCFSA-N |
| XLogP | 3.46 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |