C15H25N3O2 — CID 114707891
tert-butyl N-[[3-(1-cyclobutylethyl)imidazol-4-yl]methyl]carbamate (PubChem CID 114707891) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl N-[[3-(1-cyclobutylethyl)imidazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(1-cyclobutylethyl)imidazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 114707891 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | tert-butyl N-[[3-(1-cyclobutylethyl)imidazol-4-yl]methyl]carbamate |
| SMILES | CC(C1CCC1)n1cncc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O2/c1-11(12-6-5-7-12)18-10-16-8-13(18)9-17-14(19)20-15(2,3)4/h8,10-12H,5-7,9H2,1-4H3,(H,17,19) |
| InChIKey | LPGXFFKFULUCGL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |