C16H29N3O2 — CID 114706289
tert-butyl N-[[3-(4-methylhexan-2-yl)imidazol-4-yl]methyl]carbamate (PubChem CID 114706289) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is tert-butyl N-[[3-(4-methylhexan-2-yl)imidazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(4-methylhexan-2-yl)imidazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 114706289 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | tert-butyl N-[[3-(4-methylhexan-2-yl)imidazol-4-yl]methyl]carbamate |
| SMILES | CCC(C)CC(C)n1cncc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29N3O2/c1-7-12(2)8-13(3)19-11-17-9-14(19)10-18-15(20)21-16(4,5)6/h9,11-13H,7-8,10H2,1-6H3,(H,18,20) |
| InChIKey | SSYHISPLEPNWDK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |