C13H23N3O3S — CID 114707568
tert-butyl N-[[3-(2-methylsulfinylpropyl)imidazol-4-yl]methyl]carbamate (PubChem CID 114707568) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is tert-butyl N-[[3-(2-methylsulfinylpropyl)imidazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(2-methylsulfinylpropyl)imidazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 114707568 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | tert-butyl N-[[3-(2-methylsulfinylpropyl)imidazol-4-yl]methyl]carbamate |
| SMILES | CC(Cn1cncc1CNC(=O)OC(C)(C)C)S(C)=O |
| InChI | InChI=1S/C13H23N3O3S/c1-10(20(5)18)8-16-9-14-6-11(16)7-15-12(17)19-13(2,3)4/h6,9-10H,7-8H2,1-5H3,(H,15,17) |
| InChIKey | ZKLUCNKPSKGNKT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |