C15H25N3O2S — CID 114707406
tert-butyl N-[[3-(thian-4-ylmethyl)imidazol-4-yl]methyl]carbamate (PubChem CID 114707406) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is tert-butyl N-[[3-(thian-4-ylmethyl)imidazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(thian-4-ylmethyl)imidazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 114707406 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | tert-butyl N-[[3-(thian-4-ylmethyl)imidazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cncn1CC1CCSCC1 |
| InChI | InChI=1S/C15H25N3O2S/c1-15(2,3)20-14(19)17-9-13-8-16-11-18(13)10-12-4-6-21-7-5-12/h8,11-12H,4-7,9-10H2,1-3H3,(H,17,19) |
| InChIKey | ALDGLNGDONJIBT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |