C15H25N3O3 — CID 114705588
tert-butyl N-[[3-(2-methoxycyclopentyl)imidazol-4-yl]methyl]carbamate (PubChem CID 114705588) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl N-[[3-(2-methoxycyclopentyl)imidazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(2-methoxycyclopentyl)imidazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 114705588 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | tert-butyl N-[[3-(2-methoxycyclopentyl)imidazol-4-yl]methyl]carbamate |
| SMILES | COC1CCCC1n1cncc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O3/c1-15(2,3)21-14(19)17-9-11-8-16-10-18(11)12-6-5-7-13(12)20-4/h8,10,12-13H,5-7,9H2,1-4H3,(H,17,19) |
| InChIKey | BXDDZVPBTXZWAD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |