C13H19N3O2 — CID 114707490
tert-butyl N-[(3-but-2-ynylimidazol-4-yl)methyl]carbamate (PubChem CID 114707490) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is tert-butyl N-[(3-but-2-ynylimidazol-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-but-2-ynylimidazol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 114707490 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | tert-butyl N-[(3-but-2-ynylimidazol-4-yl)methyl]carbamate |
| SMILES | CC#CCn1cncc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19N3O2/c1-5-6-7-16-10-14-8-11(16)9-15-12(17)18-13(2,3)4/h8,10H,7,9H2,1-4H3,(H,15,17) |
| InChIKey | YPGGRBLGTKNANP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|