C13H23N3O4S — CID 114704630
tert-butyl N-[[3-(3-methylsulfonylpropyl)imidazol-4-yl]methyl]carbamate (PubChem CID 114704630) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is tert-butyl N-[[3-(3-methylsulfonylpropyl)imidazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(3-methylsulfonylpropyl)imidazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 114704630 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | tert-butyl N-[[3-(3-methylsulfonylpropyl)imidazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cncn1CCCS(C)(=O)=O |
| InChI | InChI=1S/C13H23N3O4S/c1-13(2,3)20-12(17)15-9-11-8-14-10-16(11)6-5-7-21(4,18)19/h8,10H,5-7,9H2,1-4H3,(H,15,17) |
| InChIKey | NWCGZZDIFDJKDX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |