C14H25N3O3S — CID 114707567
tert-butyl N-[1-[3-(2-methylsulfinylpropyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 114707567) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(2-methylsulfinylpropyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(2-methylsulfinylpropyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 114707567 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | tert-butyl N-[1-[3-(2-methylsulfinylpropyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1cncn1CC(C)S(C)=O |
| InChI | InChI=1S/C14H25N3O3S/c1-10(21(6)19)8-17-9-15-7-12(17)11(2)16-13(18)20-14(3,4)5/h7,9-11H,8H2,1-6H3,(H,16,18) |
| InChIKey | KLIUCTLNQJSLQR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |