C15H27N3O3 — CID 114707455
tert-butyl N-[1-[3-(2-ethoxypropyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 114707455) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(2-ethoxypropyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(2-ethoxypropyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 114707455 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | tert-butyl N-[1-[3-(2-ethoxypropyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | CCOC(C)Cn1cncc1C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O3/c1-7-20-11(2)9-18-10-16-8-13(18)12(3)17-14(19)21-15(4,5)6/h8,10-12H,7,9H2,1-6H3,(H,17,19) |
| InChIKey | NNLVEJROXDQDKF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |