C17H20ClNO4 — CID 11404979
tert-butyl N-[(R)-(4-chlorophenyl)-(5-methoxyfuran-2-yl)methyl]carbamate (PubChem CID 11404979) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is tert-butyl N-[(R)-(4-chlorophenyl)-(5-methoxyfuran-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(R)-(4-chlorophenyl)-(5-methoxyfuran-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 11404979 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | tert-butyl N-[(R)-(4-chlorophenyl)-(5-methoxyfuran-2-yl)methyl]carbamate |
| SMILES | COc1ccc([C@H](NC(=O)OC(C)(C)C)c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C17H20ClNO4/c1-17(2,3)23-16(20)19-15(11-5-7-12(18)8-6-11)13-9-10-14(21-4)22-13/h5-10,15H,1-4H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | VQXORPYGNZIIGA-OAHLLOKOSA-N |
| XLogP | 4.56 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |