C13H15ClN2O2 — CID 11242589
tert-butyl N-[(4-chlorophenyl)-cyanomethyl]carbamate (PubChem CID 11242589) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is tert-butyl N-[(4-chlorophenyl)-cyanomethyl]carbamate.
| Compound Name | tert-butyl N-[(4-chlorophenyl)-cyanomethyl]carbamate |
|---|---|
| PubChem CID | 11242589 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | tert-butyl N-[(4-chlorophenyl)-cyanomethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H15ClN2O2/c1-13(2,3)18-12(17)16-11(8-15)9-4-6-10(14)7-5-9/h4-7,11H,1-3H3,(H,16,17) |
| InChIKey | YFWXHIMUNFLFBX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |