C14H19ClN2O4 — CID 46201420
tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-nitropropyl]carbamate (PubChem CID 46201420) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-nitropropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-nitropropyl]carbamate |
|---|---|
| PubChem CID | 46201420 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-nitropropyl]carbamate |
| SMILES | C[C@H]([C@H](NC(=O)OC(C)(C)C)c1ccc(Cl)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H19ClN2O4/c1-9(17(19)20)12(10-5-7-11(15)8-6-10)16-13(18)21-14(2,3)4/h5-9,12H,1-4H3,(H,16,18)/t9-,12+/m1/s1 |
| InChIKey | VYECOLCFFYSAJS-SKDRFNHKSA-N |
| XLogP | 3.57 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|