C19H20Cl2N2O4 — CID 72724247
tert-butyl N-[(1R,2S)-1,2-bis(4-chlorophenyl)-2-nitroethyl]carbamate (PubChem CID 72724247) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-1,2-bis(4-chlorophenyl)-2-nitroethyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-1,2-bis(4-chlorophenyl)-2-nitroethyl]carbamate |
|---|---|
| PubChem CID | 72724247 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | tert-butyl N-[(1R,2S)-1,2-bis(4-chlorophenyl)-2-nitroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccc(Cl)cc1)[C@H](c1ccc(Cl)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C19H20Cl2N2O4/c1-19(2,3)27-18(24)22-16(12-4-8-14(20)9-5-12)17(23(25)26)13-6-10-15(21)11-7-13/h4-11,16-17H,1-3H3,(H,22,24)/t16-,17+/m1/s1 |
| InChIKey | NHTAJCIVJWVZNW-SJORKVTESA-N |
| XLogP | 5.58 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|