C19H31N3O3 — CID 95617125
tert-butyl N-[(1S)-1-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]carbamate (PubChem CID 95617125) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 95617125 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]carbamate |
| SMILES | COc1ccc([C@@H](CN2CCN(C)CC2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H31N3O3/c1-19(2,3)25-18(23)20-17(14-22-12-10-21(4)11-13-22)15-6-8-16(24-5)9-7-15/h6-9,17H,10-14H2,1-5H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | NMCBZWBKJWVUFR-QGZVFWFLSA-N |
| XLogP | 2.51 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |