C13H17BrN2O5 — CID 56652475
ethyl N-[(1R,2R)-2-bromo-1-(4-methoxyphenyl)-2-nitropropyl]carbamate (PubChem CID 56652475) has the molecular formula C13H17BrN2O5 and a molecular weight of 361.19 g/mol. Its IUPAC name is ethyl N-[(1R,2R)-2-bromo-1-(4-methoxyphenyl)-2-nitropropyl]carbamate.
| Compound Name | ethyl N-[(1R,2R)-2-bromo-1-(4-methoxyphenyl)-2-nitropropyl]carbamate |
|---|---|
| PubChem CID | 56652475 |
| Molecular Formula | C13H17BrN2O5 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | ethyl N-[(1R,2R)-2-bromo-1-(4-methoxyphenyl)-2-nitropropyl]carbamate |
| SMILES | CCOC(=O)N[C@H](c1ccc(OC)cc1)[C@@](C)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C13H17BrN2O5/c1-4-21-12(17)15-11(13(2,14)16(18)19)9-5-7-10(20-3)8-6-9/h5-8,11H,4H2,1-3H3,(H,15,17)/t11-,13+/m1/s1 |
| InChIKey | ZCPCOZLPJGPPDK-YPMHNXCESA-N |
| XLogP | 2.87 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|