C19H27NO6 — CID 3786807
diethyl 2-[acetamido-(4-methoxyphenyl)methyl]-2-ethylpropanedioate (PubChem CID 3786807) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is diethyl 2-[acetamido-(4-methoxyphenyl)methyl]-2-ethylpropanedioate.
| Compound Name | diethyl 2-[acetamido-(4-methoxyphenyl)methyl]-2-ethylpropanedioate |
|---|---|
| PubChem CID | 3786807 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | diethyl 2-[acetamido-(4-methoxyphenyl)methyl]-2-ethylpropanedioate |
| SMILES | CCOC(=O)C(CC)(C(=O)OCC)C(NC(C)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H27NO6/c1-6-19(17(22)25-7-2,18(23)26-8-3)16(20-13(4)21)14-9-11-15(24-5)12-10-14/h9-12,16H,6-8H2,1-5H3,(H,20,21) |
| InChIKey | CWFPCRLSYLAXGA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|