C17H23NO6S — CID 175023703
methyl 2-acetamido-3-[2-ethoxy-1-(4-methoxyphenyl)-2-oxoethyl]sulfanylpropanoate (PubChem CID 175023703) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is methyl 2-acetamido-3-[2-ethoxy-1-(4-methoxyphenyl)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 2-acetamido-3-[2-ethoxy-1-(4-methoxyphenyl)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 175023703 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | methyl 2-acetamido-3-[2-ethoxy-1-(4-methoxyphenyl)-2-oxoethyl]sulfanylpropanoate |
| SMILES | CCOC(=O)C(SCC(NC(C)=O)C(=O)OC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H23NO6S/c1-5-24-17(21)15(12-6-8-13(22-3)9-7-12)25-10-14(16(20)23-4)18-11(2)19/h6-9,14-15H,5,10H2,1-4H3,(H,18,19) |
| InChIKey | JPIGYDANJQJNLM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |