C14H18Br2N2O6 — CID 56652473
ethyl N-[(1R,2R)-2-bromo-1-(2-bromo-4,5-dimethoxyphenyl)-2-nitropropyl]carbamate (PubChem CID 56652473) has the molecular formula C14H18Br2N2O6 and a molecular weight of 470.11 g/mol. Its IUPAC name is ethyl N-[(1R,2R)-2-bromo-1-(2-bromo-4,5-dimethoxyphenyl)-2-nitropropyl]carbamate.
| Compound Name | ethyl N-[(1R,2R)-2-bromo-1-(2-bromo-4,5-dimethoxyphenyl)-2-nitropropyl]carbamate |
|---|---|
| PubChem CID | 56652473 |
| Molecular Formula | C14H18Br2N2O6 |
| Molecular Weight | 470.11 g/mol |
| Exact Mass | 467.95 |
| IUPAC Name | ethyl N-[(1R,2R)-2-bromo-1-(2-bromo-4,5-dimethoxyphenyl)-2-nitropropyl]carbamate |
| SMILES | CCOC(=O)N[C@H](c1cc(OC)c(OC)cc1Br)[C@@](C)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C14H18Br2N2O6/c1-5-24-13(19)17-12(14(2,16)18(20)21)8-6-10(22-3)11(23-4)7-9(8)15/h6-7,12H,5H2,1-4H3,(H,17,19)/t12-,14+/m1/s1 |
| InChIKey | XSWQQLDGFYXTLI-OCCSQVGLSA-N |
| XLogP | 3.64 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.11 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|