C12H13Br3N2O5 — CID 45277833
N-[2,2-dibromo-1-(2-bromo-4,5-dimethoxyphenyl)-2-nitroethyl]acetamide (PubChem CID 45277833) has the molecular formula C12H13Br3N2O5 and a molecular weight of 504.96 g/mol. Its IUPAC name is N-[2,2-dibromo-1-(2-bromo-4,5-dimethoxyphenyl)-2-nitroethyl]acetamide.
| Compound Name | N-[2,2-dibromo-1-(2-bromo-4,5-dimethoxyphenyl)-2-nitroethyl]acetamide |
|---|---|
| PubChem CID | 45277833 |
| Molecular Formula | C12H13Br3N2O5 |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 501.84 |
| IUPAC Name | N-[2,2-dibromo-1-(2-bromo-4,5-dimethoxyphenyl)-2-nitroethyl]acetamide |
| SMILES | COc1cc(Br)c(C(NC(C)=O)C(Br)(Br)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H13Br3N2O5/c1-6(18)16-11(12(14,15)17(19)20)7-4-9(21-2)10(22-3)5-8(7)13/h4-5,11H,1-3H3,(H,16,18) |
| InChIKey | GVJMVDQOCCLHNQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|