C13H19BrO3 — CID 55134769
1-(2-bromo-4,5-dimethoxyphenyl)-2,2-dimethylpropan-1-ol (PubChem CID 55134769) has the molecular formula C13H19BrO3 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 55134769 |
| Molecular Formula | C13H19BrO3 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-2,2-dimethylpropan-1-ol |
| SMILES | COc1cc(Br)c(C(O)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C13H19BrO3/c1-13(2,3)12(15)8-6-10(16-4)11(17-5)7-9(8)14/h6-7,12,15H,1-5H3 |
| InChIKey | LXLLPNJEMHTYNT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |