C12H14BrClO4 — CID 62224558
ethyl 2-(2-bromo-4,5-dimethoxyphenyl)-2-chloroacetate (PubChem CID 62224558) has the molecular formula C12H14BrClO4 and a molecular weight of 337.60 g/mol. Its IUPAC name is ethyl 2-(2-bromo-4,5-dimethoxyphenyl)-2-chloroacetate.
| Compound Name | ethyl 2-(2-bromo-4,5-dimethoxyphenyl)-2-chloroacetate |
|---|---|
| PubChem CID | 62224558 |
| Molecular Formula | C12H14BrClO4 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | ethyl 2-(2-bromo-4,5-dimethoxyphenyl)-2-chloroacetate |
| SMILES | CCOC(=O)C(Cl)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C12H14BrClO4/c1-4-18-12(15)11(14)7-5-9(16-2)10(17-3)6-8(7)13/h5-6,11H,4H2,1-3H3 |
| InChIKey | DEGIMARPAJFATG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|