C15H19IO6 — CID 25138585
diethyl 2-(2-iodo-4,5-dimethoxyphenyl)propanedioate (PubChem CID 25138585) has the molecular formula C15H19IO6 and a molecular weight of 422.22 g/mol. Its IUPAC name is diethyl 2-(2-iodo-4,5-dimethoxyphenyl)propanedioate.
| Compound Name | diethyl 2-(2-iodo-4,5-dimethoxyphenyl)propanedioate |
|---|---|
| PubChem CID | 25138585 |
| Molecular Formula | C15H19IO6 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | diethyl 2-(2-iodo-4,5-dimethoxyphenyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cc(OC)c(OC)cc1I |
| InChI | InChI=1S/C15H19IO6/c1-5-21-14(17)13(15(18)22-6-2)9-7-11(19-3)12(20-4)8-10(9)16/h7-8,13H,5-6H2,1-4H3 |
| InChIKey | GSXIRYNSMUGKLO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|