C13H17ClO3 — CID 116863130
ethyl 2-chloro-2-(2-methoxy-3,5-dimethylphenyl)acetate (PubChem CID 116863130) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is ethyl 2-chloro-2-(2-methoxy-3,5-dimethylphenyl)acetate.
| Compound Name | ethyl 2-chloro-2-(2-methoxy-3,5-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 116863130 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 2-chloro-2-(2-methoxy-3,5-dimethylphenyl)acetate |
| SMILES | CCOC(=O)C(Cl)c1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C13H17ClO3/c1-5-17-13(15)11(14)10-7-8(2)6-9(3)12(10)16-4/h6-7,11H,5H2,1-4H3 |
| InChIKey | SGEPEZSXISBLOZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|