C12H19N3O2 — CID 116848944
2-amino-2-(2-methoxy-3,5-dimethylphenyl)-N-methylacetohydrazide (PubChem CID 116848944) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-amino-2-(2-methoxy-3,5-dimethylphenyl)-N-methylacetohydrazide.
| Compound Name | 2-amino-2-(2-methoxy-3,5-dimethylphenyl)-N-methylacetohydrazide |
|---|---|
| PubChem CID | 116848944 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-amino-2-(2-methoxy-3,5-dimethylphenyl)-N-methylacetohydrazide |
| SMILES | COc1c(C)cc(C)cc1C(N)C(=O)N(C)N |
| InChI | InChI=1S/C12H19N3O2/c1-7-5-8(2)11(17-4)9(6-7)10(13)12(16)15(3)14/h5-6,10H,13-14H2,1-4H3 |
| InChIKey | RUXURMYHIOYBCN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|