C13H19ClO2 — CID 82366992
4-chloro-4-(2-methoxy-3,5-dimethylphenyl)butan-1-ol (PubChem CID 82366992) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 4-chloro-4-(2-methoxy-3,5-dimethylphenyl)butan-1-ol.
| Compound Name | 4-chloro-4-(2-methoxy-3,5-dimethylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 82366992 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-chloro-4-(2-methoxy-3,5-dimethylphenyl)butan-1-ol |
| SMILES | COc1c(C)cc(C)cc1C(Cl)CCCO |
| InChI | InChI=1S/C13H19ClO2/c1-9-7-10(2)13(16-3)11(8-9)12(14)5-4-6-15/h7-8,12,15H,4-6H2,1-3H3 |
| InChIKey | ZDHXDTYFIYXKQC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|