C13H21NO3 — CID 165351519
(1S,3S)-3-amino-1-(2-methoxy-3,5-dimethylphenyl)butane-1,4-diol (PubChem CID 165351519) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (1S,3S)-3-amino-1-(2-methoxy-3,5-dimethylphenyl)butane-1,4-diol.
| Compound Name | (1S,3S)-3-amino-1-(2-methoxy-3,5-dimethylphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 165351519 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (1S,3S)-3-amino-1-(2-methoxy-3,5-dimethylphenyl)butane-1,4-diol |
| SMILES | COc1c(C)cc(C)cc1[C@@H](O)C[C@H](N)CO |
| InChI | InChI=1S/C13H21NO3/c1-8-4-9(2)13(17-3)11(5-8)12(16)6-10(14)7-15/h4-5,10,12,15-16H,6-7,14H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | ZWIHVPRCCXOSST-JQWIXIFHSA-N |
| XLogP | 1.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |