C12H16BrNO3 — CID 8962788
ethyl N-[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]carbamate (PubChem CID 8962788) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is ethyl N-[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]carbamate.
| Compound Name | ethyl N-[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 8962788 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | ethyl N-[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]carbamate |
| SMILES | CCOC(=O)N[C@H](C)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C12H16BrNO3/c1-4-17-12(15)14-8(2)9-5-6-11(16-3)10(13)7-9/h5-8H,4H2,1-3H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | UIZVRJBWZHZDOL-MRVPVSSYSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |