C15H23BrN2O2 — CID 61178461
(2S)-2-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-methylpentanamide (PubChem CID 61178461) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 61178461 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2S)-2-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]-4-methylpentanamide |
| SMILES | COc1ccc(C(C)NC(=O)[C@@H](N)CC(C)C)cc1Br |
| InChI | InChI=1S/C15H23BrN2O2/c1-9(2)7-13(17)15(19)18-10(3)11-5-6-14(20-4)12(16)8-11/h5-6,8-10,13H,7,17H2,1-4H3,(H,18,19)/t10?,13-/m0/s1 |
| InChIKey | IBWUXWFZCNUWQY-HQVZTVAUSA-N |
| XLogP | 3.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |