C26H25NO5 — CID 4224876
ethyl N-[2-benzoyl-3-hydroxy-1-(4-methoxyphenyl)-3-phenylprop-2-enyl]carbamate (PubChem CID 4224876) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is ethyl N-[2-benzoyl-3-hydroxy-1-(4-methoxyphenyl)-3-phenylprop-2-enyl]carbamate.
| Compound Name | ethyl N-[2-benzoyl-3-hydroxy-1-(4-methoxyphenyl)-3-phenylprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 4224876 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | ethyl N-[2-benzoyl-3-hydroxy-1-(4-methoxyphenyl)-3-phenylprop-2-enyl]carbamate |
| SMILES | CCOC(=O)NC(C(C(=O)c1ccccc1)=C(O)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-3-32-26(30)27-23(18-14-16-21(31-2)17-15-18)22(24(28)19-10-6-4-7-11-19)25(29)20-12-8-5-9-13-20/h4-17,23,28H,3H2,1-2H3,(H,27,30) |
| InChIKey | LVMBMDPJWZUYNW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|