C12H18NO6P — CID 102076631
[(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]-methoxyphosphinic acid (PubChem CID 102076631) has the molecular formula C12H18NO6P and a molecular weight of 303.25 g/mol. Its IUPAC name is [(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]-methoxyphosphinic acid.
| Compound Name | [(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 102076631 |
| Molecular Formula | C12H18NO6P |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]-methoxyphosphinic acid |
| SMILES | CCOC(=O)NC(c1ccc(OC)cc1)P(=O)(O)OC |
| InChI | InChI=1S/C12H18NO6P/c1-4-19-12(14)13-11(20(15,16)18-3)9-5-7-10(17-2)8-6-9/h5-8,11H,4H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | YJZOTKJQOYDWBE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|