C13H20NO6P — CID 102076632
ethoxy-[(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]phosphinic acid (PubChem CID 102076632) has the molecular formula C13H20NO6P and a molecular weight of 317.28 g/mol. Its IUPAC name is ethoxy-[(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]phosphinic acid.
| Compound Name | ethoxy-[(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]phosphinic acid |
|---|---|
| PubChem CID | 102076632 |
| Molecular Formula | C13H20NO6P |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethoxy-[(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]phosphinic acid |
| SMILES | CCOC(=O)NC(c1ccc(OC)cc1)P(=O)(O)OCC |
| InChI | InChI=1S/C13H20NO6P/c1-4-19-13(15)14-12(21(16,17)20-5-2)10-6-8-11(18-3)9-7-10/h6-9,12H,4-5H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | LAOZGJNUULFNOZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|