C15H24NO6P — CID 131858581
(4-methoxyphenyl)methyl N-(1-diethoxyphosphorylethyl)carbamate (PubChem CID 131858581) has the molecular formula C15H24NO6P and a molecular weight of 345.33 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-(1-diethoxyphosphorylethyl)carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-(1-diethoxyphosphorylethyl)carbamate |
|---|---|
| PubChem CID | 131858581 |
| Molecular Formula | C15H24NO6P |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (4-methoxyphenyl)methyl N-(1-diethoxyphosphorylethyl)carbamate |
| SMILES | CCOP(=O)(OCC)C(C)NC(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H24NO6P/c1-5-21-23(18,22-6-2)12(3)16-15(17)20-11-13-7-9-14(19-4)10-8-13/h7-10,12H,5-6,11H2,1-4H3,(H,16,17) |
| InChIKey | FANRZKSMWKUYEY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|