C13H18NO7PS — CID 88836181
[1-dimethoxyphosphoryl-2-[(4-methoxyphenyl)methoxy]-2-oxoethyl]carbamothioic S-acid (PubChem CID 88836181) has the molecular formula C13H18NO7PS and a molecular weight of 363.33 g/mol. Its IUPAC name is [1-dimethoxyphosphoryl-2-[(4-methoxyphenyl)methoxy]-2-oxoethyl]carbamothioic S-acid.
| Compound Name | [1-dimethoxyphosphoryl-2-[(4-methoxyphenyl)methoxy]-2-oxoethyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 88836181 |
| Molecular Formula | C13H18NO7PS |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | [1-dimethoxyphosphoryl-2-[(4-methoxyphenyl)methoxy]-2-oxoethyl]carbamothioic S-acid |
| SMILES | COc1ccc(COC(=O)C(NC(=O)S)P(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C13H18NO7PS/c1-18-10-6-4-9(5-7-10)8-21-12(15)11(14-13(16)23)22(17,19-2)20-3/h4-7,11H,8H2,1-3H3,(H2,14,16,23) |
| InChIKey | LUSRXLDDJFBHTO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|