C13H18NO6P — CID 135086403
N-[1-dimethoxyphosphoryl-2-(4-methoxyphenyl)-2-oxoethyl]acetamide (PubChem CID 135086403) has the molecular formula C13H18NO6P and a molecular weight of 315.26 g/mol. Its IUPAC name is N-[1-dimethoxyphosphoryl-2-(4-methoxyphenyl)-2-oxoethyl]acetamide.
| Compound Name | N-[1-dimethoxyphosphoryl-2-(4-methoxyphenyl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 135086403 |
| Molecular Formula | C13H18NO6P |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-[1-dimethoxyphosphoryl-2-(4-methoxyphenyl)-2-oxoethyl]acetamide |
| SMILES | COc1ccc(C(=O)C(NC(C)=O)P(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C13H18NO6P/c1-9(15)14-13(21(17,19-3)20-4)12(16)10-5-7-11(18-2)8-6-10/h5-8,13H,1-4H3,(H,14,15) |
| InChIKey | FXANEJVEFOUTML-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|