C14H23O4P — CID 102580264
1-(2-diethoxyphosphorylpropyl)-4-methoxybenzene (PubChem CID 102580264) has the molecular formula C14H23O4P and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-(2-diethoxyphosphorylpropyl)-4-methoxybenzene.
| Compound Name | 1-(2-diethoxyphosphorylpropyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 102580264 |
| Molecular Formula | C14H23O4P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(2-diethoxyphosphorylpropyl)-4-methoxybenzene |
| SMILES | CCOP(=O)(OCC)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H23O4P/c1-5-17-19(15,18-6-2)12(3)11-13-7-9-14(16-4)10-8-13/h7-10,12H,5-6,11H2,1-4H3 |
| InChIKey | IOLXZUISMIFOPO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|