C16H29NO7P2 — CID 101468043
N-[bis(diethoxyphosphoryl)methyl]-4-methoxyaniline (PubChem CID 101468043) has the molecular formula C16H29NO7P2 and a molecular weight of 409.36 g/mol. Its IUPAC name is N-[bis(diethoxyphosphoryl)methyl]-4-methoxyaniline.
| Compound Name | N-[bis(diethoxyphosphoryl)methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 101468043 |
| Molecular Formula | C16H29NO7P2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[bis(diethoxyphosphoryl)methyl]-4-methoxyaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc(OC)cc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H29NO7P2/c1-6-21-25(18,22-7-2)16(26(19,23-8-3)24-9-4)17-14-10-12-15(20-5)13-11-14/h10-13,16-17H,6-9H2,1-5H3 |
| InChIKey | LETMACWNWOOFLH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|