C20H37NO7P2S — CID 57166923
N-[bis(diethoxyphosphoryl)methyl]-4-(4-methoxyphenyl)sulfanylbutan-1-amine (PubChem CID 57166923) has the molecular formula C20H37NO7P2S and a molecular weight of 497.53 g/mol. Its IUPAC name is N-[bis(diethoxyphosphoryl)methyl]-4-(4-methoxyphenyl)sulfanylbutan-1-amine.
| Compound Name | N-[bis(diethoxyphosphoryl)methyl]-4-(4-methoxyphenyl)sulfanylbutan-1-amine |
|---|---|
| PubChem CID | 57166923 |
| Molecular Formula | C20H37NO7P2S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[bis(diethoxyphosphoryl)methyl]-4-(4-methoxyphenyl)sulfanylbutan-1-amine |
| SMILES | CCOP(=O)(OCC)C(NCCCCSc1ccc(OC)cc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C20H37NO7P2S/c1-6-25-29(22,26-7-2)20(30(23,27-8-3)28-9-4)21-16-10-11-17-31-19-14-12-18(24-5)13-15-19/h12-15,20-21H,6-11,16-17H2,1-5H3 |
| InChIKey | VMJVTXSGOCIYIJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|