C14H23NOS — CID 62584307
N-[3-(4-methoxyphenyl)sulfanylpropyl]-2-methylpropan-1-amine (PubChem CID 62584307) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)sulfanylpropyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-(4-methoxyphenyl)sulfanylpropyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62584307 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-[3-(4-methoxyphenyl)sulfanylpropyl]-2-methylpropan-1-amine |
| SMILES | COc1ccc(SCCCNCC(C)C)cc1 |
| InChI | InChI=1S/C14H23NOS/c1-12(2)11-15-9-4-10-17-14-7-5-13(16-3)6-8-14/h5-8,12,15H,4,9-11H2,1-3H3 |
| InChIKey | ZDUHJHHZZHDINY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|