C20H26N2OS2 — CID 100755456
1-[3-(4-methoxyphenyl)sulfanylpropyl]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 100755456) has the molecular formula C20H26N2OS2 and a molecular weight of 374.58 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)sulfanylpropyl]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[3-(4-methoxyphenyl)sulfanylpropyl]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 100755456 |
| Molecular Formula | C20H26N2OS2 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)sulfanylpropyl]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | COc1ccc(SCCCNC(=S)Nc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26N2OS2/c1-15(2)16-5-7-17(8-6-16)22-20(24)21-13-4-14-25-19-11-9-18(23-3)10-12-19/h5-12,15H,4,13-14H2,1-3H3,(H2,21,22,24) |
| InChIKey | ZCQWSQQKVJQPRC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|