C16H17BrN2OS2 — CID 8680595
1-[2-(4-bromophenyl)sulfanylethyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 8680595) has the molecular formula C16H17BrN2OS2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)sulfanylethyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-(4-bromophenyl)sulfanylethyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8680595 |
| Molecular Formula | C16H17BrN2OS2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 1-[2-(4-bromophenyl)sulfanylethyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCSc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H17BrN2OS2/c1-20-14-6-4-13(5-7-14)19-16(21)18-10-11-22-15-8-2-12(17)3-9-15/h2-9H,10-11H2,1H3,(H2,18,19,21) |
| InChIKey | GBVFDBUCFBCNJG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|