C12H17N2O4PS — CID 134475077
1-[2-(1,3,2-dioxaphospholan-2-yloxy)ethyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 134475077) has the molecular formula C12H17N2O4PS and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-[2-(1,3,2-dioxaphospholan-2-yloxy)ethyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-(1,3,2-dioxaphospholan-2-yloxy)ethyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 134475077 |
| Molecular Formula | C12H17N2O4PS |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-[2-(1,3,2-dioxaphospholan-2-yloxy)ethyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCOP2OCCO2)cc1 |
| InChI | InChI=1S/C12H17N2O4PS/c1-15-11-4-2-10(3-5-11)14-12(20)13-6-7-16-19-17-8-9-18-19/h2-5H,6-9H2,1H3,(H2,13,14,20) |
| InChIKey | PDWGVKXSGHILAF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|