C17H18F2N2OS2 — CID 100755693
1-(2,6-difluorophenyl)-3-[3-(4-methoxyphenyl)sulfanylpropyl]thiourea (PubChem CID 100755693) has the molecular formula C17H18F2N2OS2 and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[3-(4-methoxyphenyl)sulfanylpropyl]thiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[3-(4-methoxyphenyl)sulfanylpropyl]thiourea |
|---|---|
| PubChem CID | 100755693 |
| Molecular Formula | C17H18F2N2OS2 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[3-(4-methoxyphenyl)sulfanylpropyl]thiourea |
| SMILES | COc1ccc(SCCCNC(=S)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C17H18F2N2OS2/c1-22-12-6-8-13(9-7-12)24-11-3-10-20-17(23)21-16-14(18)4-2-5-15(16)19/h2,4-9H,3,10-11H2,1H3,(H2,20,21,23) |
| InChIKey | VXRODZSCHILNMP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|