C18H20F2N2S2 — CID 100694548
1-(2,6-difluorophenyl)-3-[3-[(3-methylphenyl)methylsulfanyl]propyl]thiourea (PubChem CID 100694548) has the molecular formula C18H20F2N2S2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[3-[(3-methylphenyl)methylsulfanyl]propyl]thiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[3-[(3-methylphenyl)methylsulfanyl]propyl]thiourea |
|---|---|
| PubChem CID | 100694548 |
| Molecular Formula | C18H20F2N2S2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[3-[(3-methylphenyl)methylsulfanyl]propyl]thiourea |
| SMILES | Cc1cccc(CSCCCNC(=S)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C18H20F2N2S2/c1-13-5-2-6-14(11-13)12-24-10-4-9-21-18(23)22-17-15(19)7-3-8-16(17)20/h2-3,5-8,11H,4,9-10,12H2,1H3,(H2,21,22,23) |
| InChIKey | DJGXRSBGBPUQRR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|