C9H10F2N2S — CID 2368797
1-(2,6-difluorophenyl)-3-ethylthiourea (PubChem CID 2368797) has the molecular formula C9H10F2N2S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-ethylthiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-ethylthiourea |
|---|---|
| PubChem CID | 2368797 |
| Molecular Formula | C9H10F2N2S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1c(F)cccc1F |
| InChI | InChI=1S/C9H10F2N2S/c1-2-12-9(14)13-8-6(10)4-3-5-7(8)11/h3-5H,2H2,1H3,(H2,12,13,14) |
| InChIKey | MRPQMLBDFNHTJZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|