C17H18F2N2O3S — CID 100683284
1-(2,6-difluorophenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 100683284) has the molecular formula C17H18F2N2O3S and a molecular weight of 368.41 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100683284 |
| Molecular Formula | C17H18F2N2O3S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1cc(CNC(=S)Nc2c(F)cccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C17H18F2N2O3S/c1-22-13-7-10(8-14(23-2)16(13)24-3)9-20-17(25)21-15-11(18)5-4-6-12(15)19/h4-8H,9H2,1-3H3,(H2,20,21,25) |
| InChIKey | QSRVHHVZCSQTEG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|