C18H21ClN2O3S — CID 3416363
1-(3-chloro-2-methylphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 3416363) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3416363 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1cc(CNC(=S)Nc2cccc(Cl)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C18H21ClN2O3S/c1-11-13(19)6-5-7-14(11)21-18(25)20-10-12-8-15(22-2)17(24-4)16(9-12)23-3/h5-9H,10H2,1-4H3,(H2,20,21,25) |
| InChIKey | IIMQJJOJJOEILH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|